C21H22F16O5 — CID 87772990
(4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-methylheptyl) prop-2-enoate;(3,3,4,4,5,6,6,6-octafluoro-5-methylhexyl) prop-2-enoate (PubChem CID 87772990) has the molecular formula C21H22F16O5 and a molecular weight of 658.37 g/mol. Its IUPAC name is (4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-methylheptyl) prop-2-enoate;(3,3,4,4,5,6,6,6-octafluoro-5-methylhexyl) prop-2-enoate.
| Compound Name | (4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-methylheptyl) prop-2-enoate;(3,3,4,4,5,6,6,6-octafluoro-5-methylhexyl) prop-2-enoate |
|---|---|
| PubChem CID | 87772990 |
| Molecular Formula | C21H22F16O5 |
| Molecular Weight | 658.37 g/mol |
| Exact Mass | 658.12 |
| IUPAC Name | (4,4,5,5,6,7,7,7-octafluoro-2-hydroxy-6-methylheptyl) prop-2-enoate;(3,3,4,4,5,6,6,6-octafluoro-5-methylhexyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CC(F)(F)C(F)(F)C(C)(F)C(F)(F)F.C=CC(=O)OCCC(F)(F)C(F)(F)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F8O3.C10H10F8O2/c1-3-7(21)22-5-6(20)4-9(13,14)10(15,16)8(2,12)11(17,18)19;1-3-6(19)20-5-4-8(12,13)9(14,15)7(2,11)10(16,17)18/h3,6,20H,1,4-5H2,2H3;3H,1,4-5H2,2H3 |
| InChIKey | WKJWNPVAWDJNGP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.37 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|