C15H15F13O2 — CID 87121766
3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecyl prop-2-enoate (PubChem CID 87121766) has the molecular formula C15H15F13O2 and a molecular weight of 474.26 g/mol. Its IUPAC name is 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecyl prop-2-enoate.
| Compound Name | 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecyl prop-2-enoate |
|---|---|
| PubChem CID | 87121766 |
| Molecular Formula | C15H15F13O2 |
| Molecular Weight | 474.26 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 3,3,4,4,7,7,8,8,11,11,12,12,12-tridecafluorododecyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H15F13O2/c1-2-9(29)30-8-7-13(22,23)12(20,21)4-3-10(16,17)11(18,19)5-6-14(24,25)15(26,27)28/h2H,1,3-8H2 |
| InChIKey | JBZXKXMRSDHBBR-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.26 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|