C12H15F3O6 — CID 88573928
4-O-(2-prop-2-enoyloxyethyl) 1-O-(3,3,3-trifluoropropyl) butanedioate (PubChem CID 88573928) has the molecular formula C12H15F3O6 and a molecular weight of 312.24 g/mol. Its IUPAC name is 4-O-(2-prop-2-enoyloxyethyl) 1-O-(3,3,3-trifluoropropyl) butanedioate.
| Compound Name | 4-O-(2-prop-2-enoyloxyethyl) 1-O-(3,3,3-trifluoropropyl) butanedioate |
|---|---|
| PubChem CID | 88573928 |
| Molecular Formula | C12H15F3O6 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-O-(2-prop-2-enoyloxyethyl) 1-O-(3,3,3-trifluoropropyl) butanedioate |
| SMILES | C=CC(=O)OCCOC(=O)CCC(=O)OCCC(F)(F)F |
| InChI | InChI=1S/C12H15F3O6/c1-2-9(16)20-7-8-21-11(18)4-3-10(17)19-6-5-12(13,14)15/h2H,1,3-8H2 |
| InChIKey | QQHJKOYLSSFQOG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|