C22H36N2O8+2 — CID 102107251
2-prop-2-enoyloxyethyl 3-[1,4-dimethyl-4-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]piperazine-1,4-diium-1-yl]propanoate (PubChem CID 102107251) has the molecular formula C22H36N2O8+2 and a molecular weight of 456.54 g/mol. Its IUPAC name is 2-prop-2-enoyloxyethyl 3-[1,4-dimethyl-4-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]piperazine-1,4-diium-1-yl]propanoate.
| Compound Name | 2-prop-2-enoyloxyethyl 3-[1,4-dimethyl-4-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]piperazine-1,4-diium-1-yl]propanoate |
|---|---|
| PubChem CID | 102107251 |
| Molecular Formula | C22H36N2O8+2 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 2-prop-2-enoyloxyethyl 3-[1,4-dimethyl-4-[3-oxo-3-(2-prop-2-enoyloxyethoxy)propyl]piperazine-1,4-diium-1-yl]propanoate |
| SMILES | C=CC(=O)OCCOC(=O)CC[N+]1(C)CC[N+](C)(CCC(=O)OCCOC(=O)C=C)CC1 |
| InChI | InChI=1S/C22H36N2O8/c1-5-19(25)29-15-17-31-21(27)7-9-23(3)11-13-24(4,14-12-23)10-8-22(28)32-18-16-30-20(26)6-2/h5-6H,1-2,7-18H2,3-4H3/q+2 |
| InChIKey | KLXYNQMEFQDFAL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|