C11H17F5O5S — CID 143975331
(2,2-difluoro-2-sulfanylethyl) 3-prop-2-enoyloxypropanoate;methanol;1,1,1-trifluoroethane (PubChem CID 143975331) has the molecular formula C11H17F5O5S and a molecular weight of 356.31 g/mol. Its IUPAC name is (2,2-difluoro-2-sulfanylethyl) 3-prop-2-enoyloxypropanoate;methanol;1,1,1-trifluoroethane.
| Compound Name | (2,2-difluoro-2-sulfanylethyl) 3-prop-2-enoyloxypropanoate;methanol;1,1,1-trifluoroethane |
|---|---|
| PubChem CID | 143975331 |
| Molecular Formula | C11H17F5O5S |
| Molecular Weight | 356.31 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | (2,2-difluoro-2-sulfanylethyl) 3-prop-2-enoyloxypropanoate;methanol;1,1,1-trifluoroethane |
| SMILES | C=CC(=O)OCCC(=O)OCC(F)(F)S.CC(F)(F)F.CO |
| InChI | InChI=1S/C8H10F2O4S.C2H3F3.CH4O/c1-2-6(11)13-4-3-7(12)14-5-8(9,10)15;1-2(3,4)5;1-2/h2,15H,1,3-5H2;1H3;2H,1H3 |
| InChIKey | LZPDWPLBWCRKAU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|