C12H18F2O5S — CID 88551880
butyl 2-(2,2-difluoro-2-sulfanylethoxy)-2-prop-2-enoyloxypropanoate (PubChem CID 88551880) has the molecular formula C12H18F2O5S and a molecular weight of 312.33 g/mol. Its IUPAC name is butyl 2-(2,2-difluoro-2-sulfanylethoxy)-2-prop-2-enoyloxypropanoate.
| Compound Name | butyl 2-(2,2-difluoro-2-sulfanylethoxy)-2-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 88551880 |
| Molecular Formula | C12H18F2O5S |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | butyl 2-(2,2-difluoro-2-sulfanylethoxy)-2-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OC(C)(OCC(F)(F)S)C(=O)OCCCC |
| InChI | InChI=1S/C12H18F2O5S/c1-4-6-7-17-10(16)11(3,19-9(15)5-2)18-8-12(13,14)20/h5,20H,2,4,6-8H2,1,3H3 |
| InChIKey | UQSSYOUQDSQQQA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|