C12H8F14O2 — CID 172511249
[7-(difluoromethyl)-3,3,4,4,5,5,6,6,7,8,8,8-dodecafluorooctyl] prop-2-enoate (PubChem CID 172511249) has the molecular formula C12H8F14O2 and a molecular weight of 450.17 g/mol. Its IUPAC name is [7-(difluoromethyl)-3,3,4,4,5,5,6,6,7,8,8,8-dodecafluorooctyl] prop-2-enoate.
| Compound Name | [7-(difluoromethyl)-3,3,4,4,5,5,6,6,7,8,8,8-dodecafluorooctyl] prop-2-enoate |
|---|---|
| PubChem CID | 172511249 |
| Molecular Formula | C12H8F14O2 |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | [7-(difluoromethyl)-3,3,4,4,5,5,6,6,7,8,8,8-dodecafluorooctyl] prop-2-enoate |
| SMILES | C=CC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H8F14O2/c1-2-5(27)28-4-3-7(15,16)9(18,19)11(22,23)10(20,21)8(17,6(13)14)12(24,25)26/h2,6H,1,3-4H2 |
| InChIKey | NDZBDGSSJPULBA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|