C14H18F4O6 — CID 20668065
(4,4,5,5-tetrafluoro-2,8-dihydroxy-7-prop-2-enoyloxyoctyl) prop-2-enoate (PubChem CID 20668065) has the molecular formula C14H18F4O6 and a molecular weight of 358.28 g/mol. Its IUPAC name is (4,4,5,5-tetrafluoro-2,8-dihydroxy-7-prop-2-enoyloxyoctyl) prop-2-enoate.
| Compound Name | (4,4,5,5-tetrafluoro-2,8-dihydroxy-7-prop-2-enoyloxyoctyl) prop-2-enoate |
|---|---|
| PubChem CID | 20668065 |
| Molecular Formula | C14H18F4O6 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | (4,4,5,5-tetrafluoro-2,8-dihydroxy-7-prop-2-enoyloxyoctyl) prop-2-enoate |
| SMILES | C=CC(=O)OCC(O)CC(F)(F)C(F)(F)CC(CO)OC(=O)C=C |
| InChI | InChI=1S/C14H18F4O6/c1-3-11(21)23-8-9(20)5-13(15,16)14(17,18)6-10(7-19)24-12(22)4-2/h3-4,9-10,19-20H,1-2,5-8H2 |
| InChIKey | MEGRFFYXRNCKNW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|