C22H20F12O8 — CID 20668050
[4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-formyloxy-2,11-di(prop-2-enoyloxy)dodecyl] prop-2-enoate (PubChem CID 20668050) has the molecular formula C22H20F12O8 and a molecular weight of 640.37 g/mol. Its IUPAC name is [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-formyloxy-2,11-di(prop-2-enoyloxy)dodecyl] prop-2-enoate.
| Compound Name | [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-formyloxy-2,11-di(prop-2-enoyloxy)dodecyl] prop-2-enoate |
|---|---|
| PubChem CID | 20668050 |
| Molecular Formula | C22H20F12O8 |
| Molecular Weight | 640.37 g/mol |
| Exact Mass | 640.10 |
| IUPAC Name | [4,4,5,5,6,6,7,7,8,8,9,9-dodecafluoro-12-formyloxy-2,11-di(prop-2-enoyloxy)dodecyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(COC=O)OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C22H20F12O8/c1-4-14(36)40-10-13(42-16(38)6-3)8-18(25,26)20(29,30)22(33,34)21(31,32)19(27,28)17(23,24)7-12(9-39-11-35)41-15(37)5-2/h4-6,11-13H,1-3,7-10H2 |
| InChIKey | ZSUXHKPAOAMSQS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|