C11H13F9O4 — CID 87169418
2-methylprop-2-enoic acid;4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol (PubChem CID 87169418) has the molecular formula C11H13F9O4 and a molecular weight of 380.20 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol.
| Compound Name | 2-methylprop-2-enoic acid;4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol |
|---|---|
| PubChem CID | 87169418 |
| Molecular Formula | C11H13F9O4 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | 2-methylprop-2-enoic acid;4,4,5,5,6,6,7,7,7-nonafluoroheptane-1,2-diol |
| SMILES | C=C(C)C(=O)O.OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H7F9O2.C4H6O2/c8-4(9,1-3(18)2-17)5(10,11)6(12,13)7(14,15)16;1-3(2)4(5)6/h3,17-18H,1-2H2;1H2,2H3,(H,5,6) |
| InChIKey | XKZFPHFCSDYVLL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|