C12H18F4O6 — CID 53446164
bis(2-methylprop-2-enoic acid);2,2,3,3-tetrafluorobutane-1,4-diol (PubChem CID 53446164) has the molecular formula C12H18F4O6 and a molecular weight of 334.26 g/mol. Its IUPAC name is bis(2-methylprop-2-enoic acid);2,2,3,3-tetrafluorobutane-1,4-diol.
| Compound Name | bis(2-methylprop-2-enoic acid);2,2,3,3-tetrafluorobutane-1,4-diol |
|---|---|
| PubChem CID | 53446164 |
| Molecular Formula | C12H18F4O6 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | bis(2-methylprop-2-enoic acid);2,2,3,3-tetrafluorobutane-1,4-diol |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)O.OCC(F)(F)C(F)(F)CO |
| InChI | InChI=1S/C4H6F4O2.2C4H6O2/c5-3(6,1-9)4(7,8)2-10;2*1-3(2)4(5)6/h9-10H,1-2H2;2*1H2,2H3,(H,5,6) |
| InChIKey | RLIHUQQYKLMBNV-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|