C14H13F13O6 — CID 158981525
bis(2-fluoroprop-2-enoic acid);4,4,5,5,6,6,7,7,8,8,8-undecafluorooctane-1,2-diol (PubChem CID 158981525) has the molecular formula C14H13F13O6 and a molecular weight of 524.23 g/mol. Its IUPAC name is bis(2-fluoroprop-2-enoic acid);4,4,5,5,6,6,7,7,8,8,8-undecafluorooctane-1,2-diol.
| Compound Name | bis(2-fluoroprop-2-enoic acid);4,4,5,5,6,6,7,7,8,8,8-undecafluorooctane-1,2-diol |
|---|---|
| PubChem CID | 158981525 |
| Molecular Formula | C14H13F13O6 |
| Molecular Weight | 524.23 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | bis(2-fluoroprop-2-enoic acid);4,4,5,5,6,6,7,7,8,8,8-undecafluorooctane-1,2-diol |
| SMILES | C=C(F)C(=O)O.C=C(F)C(=O)O.OCC(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H7F11O2.2C3H3FO2/c9-4(10,1-3(21)2-20)5(11,12)6(13,14)7(15,16)8(17,18)19;2*1-2(4)3(5)6/h3,20-21H,1-2H2;2*1H2,(H,5,6) |
| InChIKey | JPBHPGUQXDMTRJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|