C20H14F24O3 — CID 139981052
(5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-tetracosafluoro-2-hydroxyhexadecyl) 2-methylprop-2-enoate (PubChem CID 139981052) has the molecular formula C20H14F24O3 and a molecular weight of 758.28 g/mol. Its IUPAC name is (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-tetracosafluoro-2-hydroxyhexadecyl) 2-methylprop-2-enoate.
| Compound Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-tetracosafluoro-2-hydroxyhexadecyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139981052 |
| Molecular Formula | C20H14F24O3 |
| Molecular Weight | 758.28 g/mol |
| Exact Mass | 758.06 |
| IUPAC Name | (5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16-tetracosafluoro-2-hydroxyhexadecyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H14F24O3/c1-6(2)8(46)47-5-7(45)3-4-10(23,24)12(27,28)14(31,32)16(35,36)18(39,40)20(43,44)19(41,42)17(37,38)15(33,34)13(29,30)11(25,26)9(21)22/h7,9,45H,1,3-5H2,2H3 |
| InChIKey | LAZQDXDBEYQTKN-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.28 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|