C14H15F9O4 — CID 121357291
[2-(2,2-difluoropropanoyloxy)-5,5,6,6,7,7,7-heptafluoroheptyl] 2-methylprop-2-enoate (PubChem CID 121357291) has the molecular formula C14H15F9O4 and a molecular weight of 418.25 g/mol. Its IUPAC name is [2-(2,2-difluoropropanoyloxy)-5,5,6,6,7,7,7-heptafluoroheptyl] 2-methylprop-2-enoate.
| Compound Name | [2-(2,2-difluoropropanoyloxy)-5,5,6,6,7,7,7-heptafluoroheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121357291 |
| Molecular Formula | C14H15F9O4 |
| Molecular Weight | 418.25 g/mol |
| Exact Mass | 418.08 |
| IUPAC Name | [2-(2,2-difluoropropanoyloxy)-5,5,6,6,7,7,7-heptafluoroheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CCC(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(C)(F)F |
| InChI | InChI=1S/C14H15F9O4/c1-7(2)9(24)26-6-8(27-10(25)11(3,15)16)4-5-12(17,18)13(19,20)14(21,22)23/h8H,1,4-6H2,2-3H3 |
| InChIKey | KZCMZAVPIRFXKC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.25 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|