C11H11F7O7S — CID 121360657
1,1-difluoro-2-oxo-2-[4,4,5,5,5-pentafluoro-1-(2-methylprop-2-enoyloxy)pentan-2-yl]oxyethanesulfonic acid (PubChem CID 121360657) has the molecular formula C11H11F7O7S and a molecular weight of 420.26 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[4,4,5,5,5-pentafluoro-1-(2-methylprop-2-enoyloxy)pentan-2-yl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[4,4,5,5,5-pentafluoro-1-(2-methylprop-2-enoyloxy)pentan-2-yl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 121360657 |
| Molecular Formula | C11H11F7O7S |
| Molecular Weight | 420.26 g/mol |
| Exact Mass | 420.01 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[4,4,5,5,5-pentafluoro-1-(2-methylprop-2-enoyloxy)pentan-2-yl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCC(CC(F)(F)C(F)(F)F)OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C11H11F7O7S/c1-5(2)7(19)24-4-6(3-9(12,13)11(16,17)18)25-8(20)10(14,15)26(21,22)23/h6H,1,3-4H2,2H3,(H,21,22,23) |
| InChIKey | CELVUDRESVENLQ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|