C15H13F15O6S — CID 121360638
1,1,2,2-tetrafluoro-3-[4,4,5,5,6,7,7,7-octafluoro-1-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptan-2-yl]oxypropane-1-sulfonic acid (PubChem CID 121360638) has the molecular formula C15H13F15O6S and a molecular weight of 606.30 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-3-[4,4,5,5,6,7,7,7-octafluoro-1-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptan-2-yl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-3-[4,4,5,5,6,7,7,7-octafluoro-1-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptan-2-yl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 121360638 |
| Molecular Formula | C15H13F15O6S |
| Molecular Weight | 606.30 g/mol |
| Exact Mass | 606.02 |
| IUPAC Name | 1,1,2,2-tetrafluoro-3-[4,4,5,5,6,7,7,7-octafluoro-1-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptan-2-yl]oxypropane-1-sulfonic acid |
| SMILES | C=C(C)C(=O)OCC(CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C15H13F15O6S/c1-6(2)8(31)35-4-7(36-5-10(18,19)15(29,30)37(32,33)34)3-9(16,17)12(21,22)11(20,13(23,24)25)14(26,27)28/h7H,1,3-5H2,2H3,(H,32,33,34) |
| InChIKey | ANIYPDYJGSZGKA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.30 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|