C18H17F13O10S — CID 121360636
1,1-difluoro-2-[4,4,5,5,6,7,7,7-octafluoro-1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethoxy]-6-(trifluoromethyl)heptan-2-yl]oxy-2-oxoethanesulfonic acid (PubChem CID 121360636) has the molecular formula C18H17F13O10S and a molecular weight of 672.36 g/mol. Its IUPAC name is 1,1-difluoro-2-[4,4,5,5,6,7,7,7-octafluoro-1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethoxy]-6-(trifluoromethyl)heptan-2-yl]oxy-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[4,4,5,5,6,7,7,7-octafluoro-1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethoxy]-6-(trifluoromethyl)heptan-2-yl]oxy-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 121360636 |
| Molecular Formula | C18H17F13O10S |
| Molecular Weight | 672.36 g/mol |
| Exact Mass | 672.03 |
| IUPAC Name | 1,1-difluoro-2-[4,4,5,5,6,7,7,7-octafluoro-1-[2-[2-(2-methylprop-2-enoyloxy)ethoxy]-2-oxoethoxy]-6-(trifluoromethyl)heptan-2-yl]oxy-2-oxoethanesulfonic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)COCC(CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OC(=O)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C18H17F13O10S/c1-8(2)11(33)40-4-3-39-10(32)7-38-6-9(41-12(34)14(21,22)42(35,36)37)5-13(19,20)16(24,25)15(23,17(26,27)28)18(29,30)31/h9H,1,3-7H2,2H3,(H,35,36,37) |
| InChIKey | MVDQTCWRFJBGBL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|