C16H15F11O4 — CID 139821954
[4,4,5,5,6,7,7,7-octafluoro-2-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate (PubChem CID 139821954) has the molecular formula C16H15F11O4 and a molecular weight of 480.27 g/mol. Its IUPAC name is [4,4,5,5,6,7,7,7-octafluoro-2-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,5,5,6,7,7,7-octafluoro-2-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139821954 |
| Molecular Formula | C16H15F11O4 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | [4,4,5,5,6,7,7,7-octafluoro-2-(2-methylprop-2-enoyloxy)-6-(trifluoromethyl)heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F)OC(=O)C(=C)C |
| InChI | InChI=1S/C16H15F11O4/c1-7(2)10(28)30-6-9(31-11(29)8(3)4)5-12(17,18)14(20,21)13(19,15(22,23)24)16(25,26)27/h9H,1,3,5-6H2,2,4H3 |
| InChIKey | GFYCTQBSOQUOBG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|