C14H15F11O3 — CID 139912991
[6,6,7,7,8,9,9,9-octafluoro-1-hydroxy-8-(trifluoromethyl)nonan-2-yl] 2-methylprop-2-enoate (PubChem CID 139912991) has the molecular formula C14H15F11O3 and a molecular weight of 440.25 g/mol. Its IUPAC name is [6,6,7,7,8,9,9,9-octafluoro-1-hydroxy-8-(trifluoromethyl)nonan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [6,6,7,7,8,9,9,9-octafluoro-1-hydroxy-8-(trifluoromethyl)nonan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139912991 |
| Molecular Formula | C14H15F11O3 |
| Molecular Weight | 440.25 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | [6,6,7,7,8,9,9,9-octafluoro-1-hydroxy-8-(trifluoromethyl)nonan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)CCCC(F)(F)C(F)(F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H15F11O3/c1-7(2)9(27)28-8(6-26)4-3-5-10(15,16)12(18,19)11(17,13(20,21)22)14(23,24)25/h8,26H,1,3-6H2,2H3 |
| InChIKey | BVNCLVOADCDXOE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|