C9H13F3O3 — CID 139913005
(5,5,5-trifluoro-1-hydroxypentan-2-yl) 2-methylprop-2-enoate (PubChem CID 139913005) has the molecular formula C9H13F3O3 and a molecular weight of 226.19 g/mol. Its IUPAC name is (5,5,5-trifluoro-1-hydroxypentan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (5,5,5-trifluoro-1-hydroxypentan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139913005 |
| Molecular Formula | C9H13F3O3 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (5,5,5-trifluoro-1-hydroxypentan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CO)CCC(F)(F)F |
| InChI | InChI=1S/C9H13F3O3/c1-6(2)8(14)15-7(5-13)3-4-9(10,11)12/h7,13H,1,3-5H2,2H3 |
| InChIKey | MTECPTWQCOBNBV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|