C13H21F3O2 — CID 170129104
(7,7,7-trifluoro-2,2-dimethylheptan-3-yl) 2-methylprop-2-enoate (PubChem CID 170129104) has the molecular formula C13H21F3O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is (7,7,7-trifluoro-2,2-dimethylheptan-3-yl) 2-methylprop-2-enoate.
| Compound Name | (7,7,7-trifluoro-2,2-dimethylheptan-3-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 170129104 |
| Molecular Formula | C13H21F3O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (7,7,7-trifluoro-2,2-dimethylheptan-3-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C13H21F3O2/c1-9(2)11(17)18-10(12(3,4)5)7-6-8-13(14,15)16/h10H,1,6-8H2,2-5H3 |
| InChIKey | WVPCTWOHLITLFT-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|