C14H16F10O2 — CID 139676594
1,1,2,2,3,3,4,10,10,10-decafluorodecyl 2-methylprop-2-enoate (PubChem CID 139676594) has the molecular formula C14H16F10O2 and a molecular weight of 406.26 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,10,10,10-decafluorodecyl 2-methylprop-2-enoate.
| Compound Name | 1,1,2,2,3,3,4,10,10,10-decafluorodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139676594 |
| Molecular Formula | C14H16F10O2 |
| Molecular Weight | 406.26 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | 1,1,2,2,3,3,4,10,10,10-decafluorodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(F)(F)C(F)(F)C(F)(F)C(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C14H16F10O2/c1-8(2)10(25)26-14(23,24)13(21,22)12(19,20)9(15)6-4-3-5-7-11(16,17)18/h9H,1,3-7H2,2H3 |
| InChIKey | HRDGNWDSENTNGF-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.26 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|