C14H19F14NO3S — CID 171932052
N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,12,12,12-tetradecafluorododecane-1-sulfonic acid (PubChem CID 171932052) has the molecular formula C14H19F14NO3S and a molecular weight of 547.35 g/mol. Its IUPAC name is N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,12,12,12-tetradecafluorododecane-1-sulfonic acid.
| Compound Name | N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,12,12,12-tetradecafluorododecane-1-sulfonic acid |
|---|---|
| PubChem CID | 171932052 |
| Molecular Formula | C14H19F14NO3S |
| Molecular Weight | 547.35 g/mol |
| Exact Mass | 547.09 |
| IUPAC Name | N-methylmethanamine;1,1,2,2,3,3,4,4,5,5,6,12,12,12-tetradecafluorododecane-1-sulfonic acid |
| SMILES | CNC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C12H12F14O3S.C2H7N/c13-6(4-2-1-3-5-7(14,15)16)8(17,18)9(19,20)10(21,22)11(23,24)12(25,26)30(27,28)29;1-3-2/h6H,1-5H2,(H,27,28,29);3H,1-2H3 |
| InChIKey | BTPFOGYTCZILGZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.35 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|