C12H15F12NO3S — CID 175529053
1,1,2,2,3,3,4,4,5,9,9,9-dodecafluorononane-1-sulfonic acid;prop-2-en-1-amine (PubChem CID 175529053) has the molecular formula C12H15F12NO3S and a molecular weight of 481.30 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,9,9,9-dodecafluorononane-1-sulfonic acid;prop-2-en-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,9,9,9-dodecafluorononane-1-sulfonic acid;prop-2-en-1-amine |
|---|---|
| PubChem CID | 175529053 |
| Molecular Formula | C12H15F12NO3S |
| Molecular Weight | 481.30 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,9,9,9-dodecafluorononane-1-sulfonic acid;prop-2-en-1-amine |
| SMILES | C=CCN.O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)CCCC(F)(F)F |
| InChI | InChI=1S/C9H8F12O3S.C3H7N/c10-4(2-1-3-5(11,12)13)6(14,15)7(16,17)8(18,19)9(20,21)25(22,23)24;1-2-3-4/h4H,1-3H2,(H,22,23,24);2H,1,3-4H2 |
| InChIKey | JKDLFCKLCLHBHG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.30 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|