C13H16F10O3S — CID 175529302
prop-2-enyl 1,1,2,2,3,3,4,10,10,10-decafluorodecane-1-sulfonate (PubChem CID 175529302) has the molecular formula C13H16F10O3S and a molecular weight of 442.32 g/mol. Its IUPAC name is prop-2-enyl 1,1,2,2,3,3,4,10,10,10-decafluorodecane-1-sulfonate.
| Compound Name | prop-2-enyl 1,1,2,2,3,3,4,10,10,10-decafluorodecane-1-sulfonate |
|---|---|
| PubChem CID | 175529302 |
| Molecular Formula | C13H16F10O3S |
| Molecular Weight | 442.32 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | prop-2-enyl 1,1,2,2,3,3,4,10,10,10-decafluorodecane-1-sulfonate |
| SMILES | C=CCOS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)CCCCCC(F)(F)F |
| InChI | InChI=1S/C13H16F10O3S/c1-2-8-26-27(24,25)13(22,23)12(20,21)11(18,19)9(14)6-4-3-5-7-10(15,16)17/h2,9H,1,3-8H2 |
| InChIKey | OEJUKDMRNRPZBP-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.32 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|