C12H19F8N — CID 175157299
1,1,2,2,3,12,12,12-octafluorododecan-1-amine (PubChem CID 175157299) has the molecular formula C12H19F8N and a molecular weight of 329.28 g/mol. Its IUPAC name is 1,1,2,2,3,12,12,12-octafluorododecan-1-amine.
| Compound Name | 1,1,2,2,3,12,12,12-octafluorododecan-1-amine |
|---|---|
| PubChem CID | 175157299 |
| Molecular Formula | C12H19F8N |
| Molecular Weight | 329.28 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1,1,2,2,3,12,12,12-octafluorododecan-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)CCCCCCCCC(F)(F)F |
| InChI | InChI=1S/C12H19F8N/c13-9(11(17,18)12(19,20)21)7-5-3-1-2-4-6-8-10(14,15)16/h9H,1-8,21H2 |
| InChIKey | YRTXVKMXNYQHPT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.28 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|