C12H19F6LiO3S — CID 141492430
lithium 1,1,2,12,12,12-hexafluorododecane-1-sulfonate (PubChem CID 141492430) has the molecular formula C12H19F6LiO3S and a molecular weight of 364.28 g/mol. Its IUPAC name is lithium 1,1,2,12,12,12-hexafluorododecane-1-sulfonate.
| Compound Name | lithium 1,1,2,12,12,12-hexafluorododecane-1-sulfonate |
|---|---|
| PubChem CID | 141492430 |
| Molecular Formula | C12H19F6LiO3S |
| Molecular Weight | 364.28 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | lithium 1,1,2,12,12,12-hexafluorododecane-1-sulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)CCCCCCCCCC(F)(F)F.[Li+] |
| InChI | InChI=1S/C12H20F6O3S.Li/c13-10(12(17,18)22(19,20)21)8-6-4-2-1-3-5-7-9-11(14,15)16;/h10H,1-9H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | OLPCXCIFAJMBRB-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|