C11H18F6O5S — CID 157285848
1,4-dioxane;1,1,2,7,7,7-hexafluoroheptane-1-sulfonic acid (PubChem CID 157285848) has the molecular formula C11H18F6O5S and a molecular weight of 376.32 g/mol. Its IUPAC name is 1,4-dioxane;1,1,2,7,7,7-hexafluoroheptane-1-sulfonic acid.
| Compound Name | 1,4-dioxane;1,1,2,7,7,7-hexafluoroheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 157285848 |
| Molecular Formula | C11H18F6O5S |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 1,4-dioxane;1,1,2,7,7,7-hexafluoroheptane-1-sulfonic acid |
| SMILES | C1COCCO1.O=S(=O)(O)C(F)(F)C(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C7H10F6O3S.C4H8O2/c8-5(7(12,13)17(14,15)16)3-1-2-4-6(9,10)11;1-2-6-4-3-5-1/h5H,1-4H2,(H,14,15,16);1-4H2 |
| InChIKey | BAFLFVRTPJWTEF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|