C10H17F8NO3S — CID 171922879
N-methylmethanamine;1,1,2,2,3,8,8,8-octafluorooctane-1-sulfonic acid (PubChem CID 171922879) has the molecular formula C10H17F8NO3S and a molecular weight of 383.30 g/mol. Its IUPAC name is N-methylmethanamine;1,1,2,2,3,8,8,8-octafluorooctane-1-sulfonic acid.
| Compound Name | N-methylmethanamine;1,1,2,2,3,8,8,8-octafluorooctane-1-sulfonic acid |
|---|---|
| PubChem CID | 171922879 |
| Molecular Formula | C10H17F8NO3S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | N-methylmethanamine;1,1,2,2,3,8,8,8-octafluorooctane-1-sulfonic acid |
| SMILES | CNC.O=S(=O)(O)C(F)(F)C(F)(F)C(F)CCCCC(F)(F)F |
| InChI | InChI=1S/C8H10F8O3S.C2H7N/c9-5(3-1-2-4-6(10,11)12)7(13,14)8(15,16)20(17,18)19;1-3-2/h5H,1-4H2,(H,17,18,19);3H,1-2H3 |
| InChIKey | WKGJPOQACXHWMT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|