C12H22F7NO3S — CID 171922810
1,1,2,2,10,10,10-heptafluorodecane-1-sulfonic acid;N-methylmethanamine (PubChem CID 171922810) has the molecular formula C12H22F7NO3S and a molecular weight of 393.37 g/mol. Its IUPAC name is 1,1,2,2,10,10,10-heptafluorodecane-1-sulfonic acid;N-methylmethanamine.
| Compound Name | 1,1,2,2,10,10,10-heptafluorodecane-1-sulfonic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 171922810 |
| Molecular Formula | C12H22F7NO3S |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 1,1,2,2,10,10,10-heptafluorodecane-1-sulfonic acid;N-methylmethanamine |
| SMILES | CNC.O=S(=O)(O)C(F)(F)C(F)(F)CCCCCCCC(F)(F)F |
| InChI | InChI=1S/C10H15F7O3S.C2H7N/c11-8(12,10(16,17)21(18,19)20)6-4-2-1-3-5-7-9(13,14)15;1-3-2/h1-7H2,(H,18,19,20);3H,1-2H3 |
| InChIKey | JDVNSYAWVFQXMN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|