C8H13F8NO3S — CID 174871702
fluoro 1,1,2,2,6,6,6-heptafluorohexane-1-sulfonate;N-methylmethanamine (PubChem CID 174871702) has the molecular formula C8H13F8NO3S and a molecular weight of 355.25 g/mol. Its IUPAC name is fluoro 1,1,2,2,6,6,6-heptafluorohexane-1-sulfonate;N-methylmethanamine.
| Compound Name | fluoro 1,1,2,2,6,6,6-heptafluorohexane-1-sulfonate;N-methylmethanamine |
|---|---|
| PubChem CID | 174871702 |
| Molecular Formula | C8H13F8NO3S |
| Molecular Weight | 355.25 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | fluoro 1,1,2,2,6,6,6-heptafluorohexane-1-sulfonate;N-methylmethanamine |
| SMILES | CNC.O=S(=O)(OF)C(F)(F)C(F)(F)CCCC(F)(F)F |
| InChI | InChI=1S/C6H6F8O3S.C2H7N/c7-4(8,2-1-3-5(9,10)11)6(12,13)18(15,16)17-14;1-3-2/h1-3H2;3H,1-2H3 |
| InChIKey | VJBUJCZKSHQAGA-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|