C2HF6LiO3S — CID 173320914
lithium;fluoro 1,1,2,2,2-pentafluoroethanesulfonate;hydride (PubChem CID 173320914) has the molecular formula C2HF6LiO3S and a molecular weight of 226.02 g/mol. Its IUPAC name is lithium;fluoro 1,1,2,2,2-pentafluoroethanesulfonate;hydride.
| Compound Name | lithium;fluoro 1,1,2,2,2-pentafluoroethanesulfonate;hydride |
|---|---|
| PubChem CID | 173320914 |
| Molecular Formula | C2HF6LiO3S |
| Molecular Weight | 226.02 g/mol |
| Exact Mass | 225.97 |
| IUPAC Name | lithium;fluoro 1,1,2,2,2-pentafluoroethanesulfonate;hydride |
| SMILES | O=S(=O)(OF)C(F)(F)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C2F6O3S.Li.H/c3-1(4,5)2(6,7)12(9,10)11-8;;/q;+1;-1 |
| InChIKey | WBCGKTPPUNMSGZ-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.02 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|