C2H2F5LiO3S — CID 173036129
lithium;hydride;1,1,2,2,2-pentafluoroethanesulfonic acid (PubChem CID 173036129) has the molecular formula C2H2F5LiO3S and a molecular weight of 208.03 g/mol. Its IUPAC name is lithium;hydride;1,1,2,2,2-pentafluoroethanesulfonic acid.
| Compound Name | lithium;hydride;1,1,2,2,2-pentafluoroethanesulfonic acid |
|---|---|
| PubChem CID | 173036129 |
| Molecular Formula | C2H2F5LiO3S |
| Molecular Weight | 208.03 g/mol |
| Exact Mass | 207.98 |
| IUPAC Name | lithium;hydride;1,1,2,2,2-pentafluoroethanesulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)F.[H-].[Li+] |
| InChI | InChI=1S/C2HF5O3S.Li.H/c3-1(4,5)2(6,7)11(8,9)10;;/h(H,8,9,10);;/q;+1;-1 |
| InChIKey | LORSKHDRYHCFNZ-UHFFFAOYSA-N |
| XLogP | -1.85 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.03 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|