C3H3F6KO6S2 — CID 173109555
potassium;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid;hydride (PubChem CID 173109555) has the molecular formula C3H3F6KO6S2 and a molecular weight of 352.27 g/mol. Its IUPAC name is potassium;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid;hydride.
| Compound Name | potassium;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid;hydride |
|---|---|
| PubChem CID | 173109555 |
| Molecular Formula | C3H3F6KO6S2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | potassium;1,1,2,2,3,3-hexafluoropropane-1,3-disulfonic acid;hydride |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C3H2F6O6S2.K.H/c4-1(5,2(6,7)16(10,11)12)3(8,9)17(13,14)15;;/h(H,10,11,12)(H,13,14,15);;/q;+1;-1 |
| InChIKey | PQONWACJJPPXGR-UHFFFAOYSA-N |
| XLogP | -2.30 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|