C4H3F8KO3S — CID 173464040
potassium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid (PubChem CID 173464040) has the molecular formula C4H3F8KO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is potassium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid.
| Compound Name | potassium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 173464040 |
| Molecular Formula | C4H3F8KO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.93 |
| IUPAC Name | potassium;hydride;1,1,2,2,3,3,4,4-octafluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)F.[H-].[K+] |
| InChI | InChI=1S/C4H2F8O3S.K.H/c5-1(6)2(7,8)3(9,10)4(11,12)16(13,14)15;;/h1H,(H,13,14,15);;/q;+1;-1 |
| InChIKey | LVPKDCJKXQARAQ-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|