C7H2F12O3S — CID 165362882
1,1,2,2,3,3,4,5,6,7,7,7-dodecafluorohept-5-ene-1-sulfonic acid (PubChem CID 165362882) has the molecular formula C7H2F12O3S and a molecular weight of 394.13 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,6,7,7,7-dodecafluorohept-5-ene-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,5,6,7,7,7-dodecafluorohept-5-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 165362882 |
| Molecular Formula | C7H2F12O3S |
| Molecular Weight | 394.13 g/mol |
| Exact Mass | 393.95 |
| IUPAC Name | 1,1,2,2,3,3,4,5,6,7,7,7-dodecafluorohept-5-ene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C7H2F12O3S/c8-1(3(10)5(13,14)15)2(9)4(11,12)6(16,17)7(18,19)23(20,21)22/h2H,(H,20,21,22) |
| InChIKey | POQDCIZTLNSNHW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.13 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|