C6HF11O3S — CID 155293424
1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-ene-1-sulfonic acid (PubChem CID 155293424) has the molecular formula C6HF11O3S and a molecular weight of 362.12 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-ene-1-sulfonic acid.
| Compound Name | 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-ene-1-sulfonic acid |
|---|---|
| PubChem CID | 155293424 |
| Molecular Formula | C6HF11O3S |
| Molecular Weight | 362.12 g/mol |
| Exact Mass | 361.95 |
| IUPAC Name | 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-ene-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C6HF11O3S/c7-1(2(8)4(11,12)13)3(9,10)5(14,15)6(16,17)21(18,19)20/h(H,18,19,20) |
| InChIKey | ZTMWZBVGFKTUKA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.12 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|