C5H2F8O5S — CID 87387700
2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid (PubChem CID 87387700) has the molecular formula C5H2F8O5S and a molecular weight of 326.12 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid |
|---|---|
| PubChem CID | 87387700 |
| Molecular Formula | C5H2F8O5S |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C5H2F8O5S/c6-2(7,1(14)15)3(8,9)4(10,11)5(12,13)19(16,17)18/h(H,14,15)(H,16,17,18) |
| InChIKey | XGJLBNPYUPDHBQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|