C29H22F8O5S3 — CID 173109378
2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid;bis(2-phenylbenzenethiol) (PubChem CID 173109378) has the molecular formula C29H22F8O5S3 and a molecular weight of 698.68 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid;bis(2-phenylbenzenethiol).
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid;bis(2-phenylbenzenethiol) |
|---|---|
| PubChem CID | 173109378 |
| Molecular Formula | C29H22F8O5S3 |
| Molecular Weight | 698.68 g/mol |
| Exact Mass | 698.05 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-5-sulfopentanoic acid;bis(2-phenylbenzenethiol) |
| SMILES | O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)O.Sc1ccccc1-c1ccccc1.Sc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/2C12H10S.C5H2F8O5S/c2*13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;6-2(7,1(14)15)3(8,9)4(10,11)5(12,13)19(16,17)18/h2*1-9,13H;(H,14,15)(H,16,17,18) |
| InChIKey | LTBMQKVPOILKSJ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.68 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|