C22H15F9O4S2 — CID 173205679
2,3-diphenyl-4-sulfanylphenol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid (PubChem CID 173205679) has the molecular formula C22H15F9O4S2 and a molecular weight of 578.47 g/mol. Its IUPAC name is 2,3-diphenyl-4-sulfanylphenol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid.
| Compound Name | 2,3-diphenyl-4-sulfanylphenol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
|---|---|
| PubChem CID | 173205679 |
| Molecular Formula | C22H15F9O4S2 |
| Molecular Weight | 578.47 g/mol |
| Exact Mass | 578.03 |
| IUPAC Name | 2,3-diphenyl-4-sulfanylphenol;1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.Oc1ccc(S)c(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H14OS.C4HF9O3S/c19-15-11-12-16(20)18(14-9-5-2-6-10-14)17(15)13-7-3-1-4-8-13;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h1-12,19-20H;(H,14,15,16) |
| InChIKey | KRVREKBPOJWMRS-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.47 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|