C4H4F6O12S4 — CID 87431727
2,2,3,3,4,4-hexafluorobutane-1,1,1,4-tetrasulfonic acid (PubChem CID 87431727) has the molecular formula C4H4F6O12S4 and a molecular weight of 486.32 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluorobutane-1,1,1,4-tetrasulfonic acid.
| Compound Name | 2,2,3,3,4,4-hexafluorobutane-1,1,1,4-tetrasulfonic acid |
|---|---|
| PubChem CID | 87431727 |
| Molecular Formula | C4H4F6O12S4 |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.85 |
| IUPAC Name | 2,2,3,3,4,4-hexafluorobutane-1,1,1,4-tetrasulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(S(=O)(=O)O)(S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C4H4F6O12S4/c5-1(6,3(9,10)23(11,12)13)2(7,8)4(24(14,15)16,25(17,18)19)26(20,21)22/h(H,11,12,13)(H,14,15,16)(H,17,18,19)(H,20,21,22) |
| InChIKey | LOCZSHFINMYNOK-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|