C6H2F11N — CID 173458712
1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-en-1-amine (PubChem CID 173458712) has the molecular formula C6H2F11N and a molecular weight of 297.07 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-en-1-amine.
| Compound Name | 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-en-1-amine |
|---|---|
| PubChem CID | 173458712 |
| Molecular Formula | C6H2F11N |
| Molecular Weight | 297.07 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 1,1,2,2,3,3,4,5,6,6,6-undecafluorohex-4-en-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)(F)C(F)=C(F)C(F)(F)F |
| InChI | InChI=1S/C6H2F11N/c7-1(2(8)4(11,12)13)3(9,10)5(14,15)6(16,17)18/h18H2 |
| InChIKey | ABWVLUTYZBHHTQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.07 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|