C8F16 — CID 173307973
1,1,1,2,3,4,4,4-octafluorobut-2-ene;1,1,2,3,3,4,4,4-octafluorobut-1-ene (PubChem CID 173307973) has the molecular formula C8F16 and a molecular weight of 400.06 g/mol. Its IUPAC name is 1,1,1,2,3,4,4,4-octafluorobut-2-ene;1,1,2,3,3,4,4,4-octafluorobut-1-ene.
| Compound Name | 1,1,1,2,3,4,4,4-octafluorobut-2-ene;1,1,2,3,3,4,4,4-octafluorobut-1-ene |
|---|---|
| PubChem CID | 173307973 |
| Molecular Formula | C8F16 |
| Molecular Weight | 400.06 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 1,1,1,2,3,4,4,4-octafluorobut-2-ene;1,1,2,3,3,4,4,4-octafluorobut-1-ene |
| SMILES | FC(=C(F)C(F)(F)F)C(F)(F)F.FC(F)=C(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/2C4F8/c5-1(2(6)7)3(8,9)4(10,11)12;5-1(3(7,8)9)2(6)4(10,11)12 |
| InChIKey | ZQOPDIJWJZVOGC-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.06 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|