C5F10O — CID 131973025
1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yl hypofluorite (PubChem CID 131973025) has the molecular formula C5F10O and a molecular weight of 266.03 g/mol. Its IUPAC name is 1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yl hypofluorite.
| Compound Name | 1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yl hypofluorite |
|---|---|
| PubChem CID | 131973025 |
| Molecular Formula | C5F10O |
| Molecular Weight | 266.03 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 1,1,1,2,3,3,4,5,5-nonafluoropent-4-en-2-yl hypofluorite |
| SMILES | FOC(F)(C(F)(F)F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C5F10O/c6-1(2(7)8)3(9,10)4(11,16-15)5(12,13)14 |
| InChIKey | CNEHJYKAWWUJHO-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.03 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |