C6Cl2F8O — CID 15510226
4,4-dichloro-1,1,2,3,3-pentafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene (PubChem CID 15510226) has the molecular formula C6Cl2F8O and a molecular weight of 310.96 g/mol. Its IUPAC name is 4,4-dichloro-1,1,2,3,3-pentafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene.
| Compound Name | 4,4-dichloro-1,1,2,3,3-pentafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene |
|---|---|
| PubChem CID | 15510226 |
| Molecular Formula | C6Cl2F8O |
| Molecular Weight | 310.96 g/mol |
| Exact Mass | 309.92 |
| IUPAC Name | 4,4-dichloro-1,1,2,3,3-pentafluoro-4-(1,2,2-trifluoroethenoxy)but-1-ene |
| SMILES | FC(F)=C(F)OC(Cl)(Cl)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C6Cl2F8O/c7-6(8,17-4(14)3(12)13)5(15,16)1(9)2(10)11 |
| InChIKey | VLGLTTDFXUHSON-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.96 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|