C7F12O2 — CID 175690413
1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]prop-1-ene (PubChem CID 175690413) has the molecular formula C7F12O2 and a molecular weight of 344.05 g/mol. Its IUPAC name is 1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]prop-1-ene.
| Compound Name | 1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]prop-1-ene |
|---|---|
| PubChem CID | 175690413 |
| Molecular Formula | C7F12O2 |
| Molecular Weight | 344.05 g/mol |
| Exact Mass | 343.97 |
| IUPAC Name | 1,1,2,3,3-pentafluoro-3-[1,1,2,2-tetrafluoro-2-(1,2,2-trifluoroethenoxy)ethoxy]prop-1-ene |
| SMILES | FC(F)=C(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C7F12O2/c8-1(2(9)10)5(14,15)21-7(18,19)6(16,17)20-4(13)3(11)12 |
| InChIKey | XQTDMKLLQKUWIT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.05 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|