C5F9NaO4S — CID 175755990
sodium 1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethanesulfonate (PubChem CID 175755990) has the molecular formula C5F9NaO4S and a molecular weight of 350.09 g/mol. Its IUPAC name is sodium 1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethanesulfonate.
| Compound Name | sodium 1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethanesulfonate |
|---|---|
| PubChem CID | 175755990 |
| Molecular Formula | C5F9NaO4S |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 349.93 |
| IUPAC Name | sodium 1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)OC(F)(F)C(F)=C(F)F.[Na+] |
| InChI | InChI=1S/C5HF9O4S.Na/c6-1(2(7)8)3(9,10)18-4(11,12)5(13,14)19(15,16)17;/h(H,15,16,17);/q;+1/p-1 |
| InChIKey | KIHGPDLXCDMUEE-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|