C9F18O3 — CID 175703673
1,1,2,2,3,3-hexafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethoxy]-3-(trifluoromethoxy)propane (PubChem CID 175703673) has the molecular formula C9F18O3 and a molecular weight of 498.06 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethoxy]-3-(trifluoromethoxy)propane.
| Compound Name | 1,1,2,2,3,3-hexafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethoxy]-3-(trifluoromethoxy)propane |
|---|---|
| PubChem CID | 175703673 |
| Molecular Formula | C9F18O3 |
| Molecular Weight | 498.06 g/mol |
| Exact Mass | 497.96 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-1-[1,1,2,2-tetrafluoro-2-(1,1,2,3,3-pentafluoroprop-2-enoxy)ethoxy]-3-(trifluoromethoxy)propane |
| SMILES | FC(F)=C(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)OC(F)(F)F |
| InChI | InChI=1S/C9F18O3/c10-1(2(11)12)3(13,14)28-7(21,22)8(23,24)29-5(17,18)4(15,16)6(19,20)30-9(25,26)27 |
| InChIKey | MMNRFVDNFDTXGL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.06 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|