C11H8F13NO2 — CID 138750246
4-[1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)butyl]morpholine (PubChem CID 138750246) has the molecular formula C11H8F13NO2 and a molecular weight of 433.16 g/mol. Its IUPAC name is 4-[1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)butyl]morpholine.
| Compound Name | 4-[1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)butyl]morpholine |
|---|---|
| PubChem CID | 138750246 |
| Molecular Formula | C11H8F13NO2 |
| Molecular Weight | 433.16 g/mol |
| Exact Mass | 433.03 |
| IUPAC Name | 4-[1,1,2,2,3,3,4,4-octafluoro-4-(1,1,2,3,3-pentafluoroprop-2-enoxy)butyl]morpholine |
| SMILES | FC(F)=C(F)C(F)(F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)N1CCOCC1 |
| InChI | InChI=1S/C11H8F13NO2/c12-5(6(13)14)7(15,16)27-11(23,24)9(19,20)8(17,18)10(21,22)25-1-3-26-4-2-25/h1-4H2 |
| InChIKey | OXEBDECHTSSTRR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.16 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|