C7H8F5NO — CID 118673874
4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)morpholine (PubChem CID 118673874) has the molecular formula C7H8F5NO and a molecular weight of 217.14 g/mol. Its IUPAC name is 4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)morpholine.
| Compound Name | 4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)morpholine |
|---|---|
| PubChem CID | 118673874 |
| Molecular Formula | C7H8F5NO |
| Molecular Weight | 217.14 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4-(1,1,3,3,3-pentafluoroprop-1-en-2-yl)morpholine |
| SMILES | FC(F)=C(N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C7H8F5NO/c8-6(9)5(7(10,11)12)13-1-3-14-4-2-13/h1-4H2 |
| InChIKey | XINZIJOYIGRIFI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.14 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |